C25H31F3N4O4S — CID 155115369
N-[[(3S)-2'-(2-cyclopropylethyl)-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]methyl]methanesulfonamide (PubChem CID 155115369) has the molecular formula C25H31F3N4O4S and a molecular weight of 540.61 g/mol. Its IUPAC name is N-[[(3S)-2'-(2-cyclopropylethyl)-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3S)-2'-(2-cyclopropylethyl)-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 155115369 |
| Molecular Formula | C25H31F3N4O4S |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | N-[[(3S)-2'-(2-cyclopropylethyl)-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1c2c(nn1CCC1CC1)C[C@]1(CCc3cc(OCCCC(F)(F)F)ccc31)NC2=O |
| InChI | InChI=1S/C25H31F3N4O4S/c1-37(34,35)29-15-21-22-20(31-32(21)11-8-16-3-4-16)14-24(30-23(22)33)10-7-17-13-18(5-6-19(17)24)36-12-2-9-25(26,27)28/h5-6,13,16,29H,2-4,7-12,14-15H2,1H3,(H,30,33)/t24-/m0/s1 |
| InChIKey | VPMGRIDUYXMGGE-DEOSSOPVSA-N |
| XLogP | 3.58 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|