C29H31F3N4O5S — CID 155115372
N-[(3S)-1'-[(2-methylphenyl)methyl]-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide (PubChem CID 155115372) has the molecular formula C29H31F3N4O5S and a molecular weight of 604.65 g/mol. Its IUPAC name is N-[(3S)-1'-[(2-methylphenyl)methyl]-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide.
| Compound Name | N-[(3S)-1'-[(2-methylphenyl)methyl]-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 155115372 |
| Molecular Formula | C29H31F3N4O5S |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | N-[(3S)-1'-[(2-methylphenyl)methyl]-4'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
| SMILES | Cc1ccccc1Cn1nc(NC(=O)CS(C)(=O)=O)c2c1C[C@]1(CCc3cc(OCCCC(F)(F)F)ccc31)NC2=O |
| InChI | InChI=1S/C29H31F3N4O5S/c1-18-6-3-4-7-20(18)16-36-23-15-28(34-27(38)25(23)26(35-36)33-24(37)17-42(2,39)40)12-10-19-14-21(8-9-22(19)28)41-13-5-11-29(30,31)32/h3-4,6-9,14H,5,10-13,15-17H2,1-2H3,(H,34,38)(H,33,35,37)/t28-/m0/s1 |
| InChIKey | PAQVKDMXGMPQBL-NDEPHWFRSA-N |
| XLogP | 4.07 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|