C23H27F3N4O6S — CID 155115398
N-[(3S)-2'-(2-ethoxyethyl)-4'-oxo-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide (PubChem CID 155115398) has the molecular formula C23H27F3N4O6S and a molecular weight of 544.55 g/mol. Its IUPAC name is N-[(3S)-2'-(2-ethoxyethyl)-4'-oxo-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide.
| Compound Name | N-[(3S)-2'-(2-ethoxyethyl)-4'-oxo-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 155115398 |
| Molecular Formula | C23H27F3N4O6S |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | N-[(3S)-2'-(2-ethoxyethyl)-4'-oxo-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
| SMILES | CCOCCn1nc2c(c1NC(=O)CS(C)(=O)=O)C(=O)N[C@@]1(CCc3cc(OCC(F)(F)F)ccc31)C2 |
| InChI | InChI=1S/C23H27F3N4O6S/c1-3-35-9-8-30-20(27-18(31)12-37(2,33)34)19-17(29-30)11-22(28-21(19)32)7-6-14-10-15(4-5-16(14)22)36-13-23(24,25)26/h4-5,10H,3,6-9,11-13H2,1-2H3,(H,27,31)(H,28,32)/t22-/m0/s1 |
| InChIKey | BTYNYJGMBNLNET-QFIPXVFZSA-N |
| XLogP | 1.97 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|