C19H21F3N2O5 — CID 155115681
methyl (3S)-4-[(2-cyanoacetyl)amino]-4-[4-(4,4,4-trifluorobutoxy)phenyl]oxolane-3-carboxylate (PubChem CID 155115681) has the molecular formula C19H21F3N2O5 and a molecular weight of 414.38 g/mol. Its IUPAC name is methyl (3S)-4-[(2-cyanoacetyl)amino]-4-[4-(4,4,4-trifluorobutoxy)phenyl]oxolane-3-carboxylate.
| Compound Name | methyl (3S)-4-[(2-cyanoacetyl)amino]-4-[4-(4,4,4-trifluorobutoxy)phenyl]oxolane-3-carboxylate |
|---|---|
| PubChem CID | 155115681 |
| Molecular Formula | C19H21F3N2O5 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | methyl (3S)-4-[(2-cyanoacetyl)amino]-4-[4-(4,4,4-trifluorobutoxy)phenyl]oxolane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1COCC1(NC(=O)CC#N)c1ccc(OCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H21F3N2O5/c1-27-17(26)15-11-28-12-18(15,24-16(25)7-9-23)13-3-5-14(6-4-13)29-10-2-8-19(20,21)22/h3-6,15H,2,7-8,10-12H2,1H3,(H,24,25)/t15-,18?/m0/s1 |
| InChIKey | FAKIFRRJWWREEQ-BUSXIPJBSA-N |
| XLogP | 2.45 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|