C24H24F8N4O6S — CID 155115812
2-methylsulfonyl-N-[(3R)-4'-oxo-6-(2,2,3,3,3-pentafluoropropoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide (PubChem CID 155115812) has the molecular formula C24H24F8N4O6S and a molecular weight of 648.53 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[(3R)-4'-oxo-6-(2,2,3,3,3-pentafluoropropoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide.
| Compound Name | 2-methylsulfonyl-N-[(3R)-4'-oxo-6-(2,2,3,3,3-pentafluoropropoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide |
|---|---|
| PubChem CID | 155115812 |
| Molecular Formula | C24H24F8N4O6S |
| Molecular Weight | 648.53 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | 2-methylsulfonyl-N-[(3R)-4'-oxo-6-(2,2,3,3,3-pentafluoropropoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide |
| SMILES | CS(=O)(=O)CC(=O)Nc1c2c(nn1CCCOC(F)(F)F)C[C@@]1(CCc3cc(OCC(F)(F)C(F)(F)F)ccc31)NC2=O |
| InChI | InChI=1S/C24H24F8N4O6S/c1-43(39,40)11-17(37)33-19-18-16(35-36(19)7-2-8-42-24(30,31)32)10-21(34-20(18)38)6-5-13-9-14(3-4-15(13)21)41-12-22(25,26)23(27,28)29/h3-4,9H,2,5-8,10-12H2,1H3,(H,33,37)(H,34,38)/t21-/m1/s1 |
| InChIKey | YJOKKNIHMIAEPU-OAQYLSRUSA-N |
| XLogP | 3.50 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|