C27H30F6N4O3 — CID 155115823
N-[(4S)-2'-(2-cyclopropylethyl)-4'-oxo-7-(4,4,4-trifluorobutoxy)spiro[2,3-dihydro-1H-naphthalene-4,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-3,3,3-trifluoropropanamide (PubChem CID 155115823) has the molecular formula C27H30F6N4O3 and a molecular weight of 572.55 g/mol. Its IUPAC name is N-[(4S)-2'-(2-cyclopropylethyl)-4'-oxo-7-(4,4,4-trifluorobutoxy)spiro[2,3-dihydro-1H-naphthalene-4,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[(4S)-2'-(2-cyclopropylethyl)-4'-oxo-7-(4,4,4-trifluorobutoxy)spiro[2,3-dihydro-1H-naphthalene-4,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 155115823 |
| Molecular Formula | C27H30F6N4O3 |
| Molecular Weight | 572.55 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | N-[(4S)-2'-(2-cyclopropylethyl)-4'-oxo-7-(4,4,4-trifluorobutoxy)spiro[2,3-dihydro-1H-naphthalene-4,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-3,3,3-trifluoropropanamide |
| SMILES | O=C(CC(F)(F)F)Nc1c2c(nn1CCC1CC1)C[C@]1(CCCc3cc(OCCCC(F)(F)F)ccc31)NC2=O |
| InChI | InChI=1S/C27H30F6N4O3/c28-26(29,30)10-2-12-40-18-6-7-19-17(13-18)3-1-9-25(19)14-20-22(24(39)35-25)23(34-21(38)15-27(31,32)33)37(36-20)11-8-16-4-5-16/h6-7,13,16H,1-5,8-12,14-15H2,(H,34,38)(H,35,39)/t25-/m0/s1 |
| InChIKey | SEWIFRATRBKSRF-VWLOTQADSA-N |
| XLogP | 5.81 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|