C23H25F5N4O6S — CID 155115945
N-[(3R)-2'-[3-(difluoromethoxy)propyl]-4'-oxo-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide (PubChem CID 155115945) has the molecular formula C23H25F5N4O6S and a molecular weight of 580.53 g/mol. Its IUPAC name is N-[(3R)-2'-[3-(difluoromethoxy)propyl]-4'-oxo-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide.
| Compound Name | N-[(3R)-2'-[3-(difluoromethoxy)propyl]-4'-oxo-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 155115945 |
| Molecular Formula | C23H25F5N4O6S |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | N-[(3R)-2'-[3-(difluoromethoxy)propyl]-4'-oxo-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
| SMILES | CS(=O)(=O)CC(=O)Nc1c2c(nn1CCCOC(F)F)C[C@@]1(CCc3cc(OCC(F)(F)F)ccc31)NC2=O |
| InChI | InChI=1S/C23H25F5N4O6S/c1-39(35,36)11-17(33)29-19-18-16(31-32(19)7-2-8-37-21(24)25)10-22(30-20(18)34)6-5-13-9-14(3-4-15(13)22)38-12-23(26,27)28/h3-4,9,21H,2,5-8,10-12H2,1H3,(H,29,33)(H,30,34)/t22-/m1/s1 |
| InChIKey | XVZIXBQZWOPEEN-JOCHJYFZSA-N |
| XLogP | 2.56 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|