C25H28F6N4O6S — CID 155115995
2-methylsulfonyl-N-[(3R)-4'-oxo-6-(4,4,4-trifluorobutoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide (PubChem CID 155115995) has the molecular formula C25H28F6N4O6S and a molecular weight of 626.58 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[(3R)-4'-oxo-6-(4,4,4-trifluorobutoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide.
| Compound Name | 2-methylsulfonyl-N-[(3R)-4'-oxo-6-(4,4,4-trifluorobutoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide |
|---|---|
| PubChem CID | 155115995 |
| Molecular Formula | C25H28F6N4O6S |
| Molecular Weight | 626.58 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | 2-methylsulfonyl-N-[(3R)-4'-oxo-6-(4,4,4-trifluorobutoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide |
| SMILES | CS(=O)(=O)CC(=O)Nc1c2c(nn1CCCOC(F)(F)F)C[C@@]1(CCc3cc(OCCCC(F)(F)F)ccc31)NC2=O |
| InChI | InChI=1S/C25H28F6N4O6S/c1-42(38,39)14-19(36)32-21-20-18(34-35(21)9-3-11-41-25(29,30)31)13-23(33-22(20)37)8-6-15-12-16(4-5-17(15)23)40-10-2-7-24(26,27)28/h4-5,12H,2-3,6-11,13-14H2,1H3,(H,32,36)(H,33,37)/t23-/m1/s1 |
| InChIKey | CRUOARYDRDMDPM-HSZRJFAPSA-N |
| XLogP | 3.64 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|