C26H30F4N4O6S — CID 155116022
N-[(3S)-6-[(3,3-difluorocyclobutyl)methoxy]-2'-[3-(difluoromethoxy)propyl]-4'-oxospiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide (PubChem CID 155116022) has the molecular formula C26H30F4N4O6S and a molecular weight of 602.61 g/mol. Its IUPAC name is N-[(3S)-6-[(3,3-difluorocyclobutyl)methoxy]-2'-[3-(difluoromethoxy)propyl]-4'-oxospiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide.
| Compound Name | N-[(3S)-6-[(3,3-difluorocyclobutyl)methoxy]-2'-[3-(difluoromethoxy)propyl]-4'-oxospiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 155116022 |
| Molecular Formula | C26H30F4N4O6S |
| Molecular Weight | 602.61 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | N-[(3S)-6-[(3,3-difluorocyclobutyl)methoxy]-2'-[3-(difluoromethoxy)propyl]-4'-oxospiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
| SMILES | CS(=O)(=O)CC(=O)Nc1c2c(nn1CCCOC(F)F)C[C@]1(CCc3cc(OCC4CC(F)(F)C4)ccc31)NC2=O |
| InChI | InChI=1S/C26H30F4N4O6S/c1-41(37,38)14-20(35)31-22-21-19(33-34(22)7-2-8-39-24(27)28)12-25(32-23(21)36)6-5-16-9-17(3-4-18(16)25)40-13-15-10-26(29,30)11-15/h3-4,9,15,24H,2,5-8,10-14H2,1H3,(H,31,35)(H,32,36)/t25-/m0/s1 |
| InChIKey | OGDNRJVFMVKCDC-VWLOTQADSA-N |
| XLogP | 3.05 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|