C22H36N2O6 — CID 155116665
1-[4-methyl-3-oxo-4-[2-[2-(3,3,4-trimethyl-2-oxopentoxy)ethoxy]ethylamino]pentyl]pyrrole-2,5-dione (PubChem CID 155116665) has the molecular formula C22H36N2O6 and a molecular weight of 424.54 g/mol. Its IUPAC name is 1-[4-methyl-3-oxo-4-[2-[2-(3,3,4-trimethyl-2-oxopentoxy)ethoxy]ethylamino]pentyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-methyl-3-oxo-4-[2-[2-(3,3,4-trimethyl-2-oxopentoxy)ethoxy]ethylamino]pentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 155116665 |
| Molecular Formula | C22H36N2O6 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 1-[4-methyl-3-oxo-4-[2-[2-(3,3,4-trimethyl-2-oxopentoxy)ethoxy]ethylamino]pentyl]pyrrole-2,5-dione |
| SMILES | CC(C)C(C)(C)C(=O)COCCOCCNC(C)(C)C(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H36N2O6/c1-16(2)21(3,4)18(26)15-30-14-13-29-12-10-23-22(5,6)17(25)9-11-24-19(27)7-8-20(24)28/h7-8,16,23H,9-15H2,1-6H3 |
| InChIKey | CQSBGGRRLAHZHZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|