C19H19F2N7O2 — CID 155117172
(4R)-20-amino-4,9-difluoro-13-oxa-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one (PubChem CID 155117172) has the molecular formula C19H19F2N7O2 and a molecular weight of 415.40 g/mol. Its IUPAC name is (4R)-20-amino-4,9-difluoro-13-oxa-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one.
| Compound Name | (4R)-20-amino-4,9-difluoro-13-oxa-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one |
|---|---|
| PubChem CID | 155117172 |
| Molecular Formula | C19H19F2N7O2 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (4R)-20-amino-4,9-difluoro-13-oxa-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one |
| SMILES | Nc1nn2ccc3nc2c1C(=O)NCCCOc1ncc(F)cc1C1C[C@@H](F)CN31 |
| InChI | InChI=1S/C19H19F2N7O2/c20-10-6-12-13-7-11(21)9-27(13)14-2-4-28-17(25-14)15(16(22)26-28)18(29)23-3-1-5-30-19(12)24-8-10/h2,4,6,8,11,13H,1,3,5,7,9H2,(H2,22,26)(H,23,29)/t11-,13?/m1/s1 |
| InChIKey | HOXCAURHIUIQJM-JTDNENJMSA-N |
| XLogP | 1.65 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |