C18H30N2O4 — CID 15511720
2-[(3S,6R,10E)-1-methyl-2,5-dioxo-3-propan-2-yl-1,4-diazacyclotetradec-10-en-6-yl]acetic acid (PubChem CID 15511720) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-[(3S,6R,10E)-1-methyl-2,5-dioxo-3-propan-2-yl-1,4-diazacyclotetradec-10-en-6-yl]acetic acid.
| Compound Name | 2-[(3S,6R,10E)-1-methyl-2,5-dioxo-3-propan-2-yl-1,4-diazacyclotetradec-10-en-6-yl]acetic acid |
|---|---|
| PubChem CID | 15511720 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 2-[(3S,6R,10E)-1-methyl-2,5-dioxo-3-propan-2-yl-1,4-diazacyclotetradec-10-en-6-yl]acetic acid |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](CC(=O)O)CCC/C=C/CCCN(C)C1=O |
| InChI | InChI=1S/C18H30N2O4/c1-13(2)16-18(24)20(3)11-9-7-5-4-6-8-10-14(12-15(21)22)17(23)19-16/h4-5,13-14,16H,6-12H2,1-3H3,(H,19,23)(H,21,22)/b5-4+/t14-,16+/m1/s1 |
| InChIKey | RMMMJMCWOILAQD-SBAHZNLJSA-N |
| XLogP | 2.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|