About 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine
1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine (PubChem CID 155118393) has the molecular formula C10H20F2N2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine |
| PubChem CID | 155118393 |
| Molecular Formula | C10H20F2N2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine |
| SMILES | CN1CC(F)N(CC(C)(C)C)CC1F |
| InChI | InChI=1S/C10H20F2N2/c1-10(2,3)7-14-6-8(11)13(4)5-9(14)12/h8-9H,5-7H2,1-4H3 |
| InChIKey | MYWZUKWYUSVMCJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine?
The IUPAC name of 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine (CID 155118393) is 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine.
What is the SMILES notation for 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine?
The canonical SMILES for 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine is CN1CC(F)N(CC(C)(C)C)CC1F.
What is the InChIKey of 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine?
The InChIKey is MYWZUKWYUSVMCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F2N2/c1-10(2,3)7-14-6-8(11)13(4)5-9(14)12/h8-9H,5-7H2,1-4H3.
What are the key properties of 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine?
1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine has a molecular weight of 206.28 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropyl)-2,5-difluoro-4-methylpiperazine is sourced from PubChem (CID 155118393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).