About 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine
1-(3,3-dimethylpentyl)-3,3-difluoropiperazine (PubChem CID 155118505) has the molecular formula C11H22F2N2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine.
Molecular Properties
| Compound Name | 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine |
| PubChem CID | 155118505 |
| Molecular Formula | C11H22F2N2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine |
| SMILES | CCC(C)(C)CCN1CCNC(F)(F)C1 |
| InChI | InChI=1S/C11H22F2N2/c1-4-10(2,3)5-7-15-8-6-14-11(12,13)9-15/h14H,4-9H2,1-3H3 |
| InChIKey | YJNBDDJDQCZPJX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine?
The IUPAC name of 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine (CID 155118505) is 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine.
What is the SMILES notation for 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine?
The canonical SMILES for 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine is CCC(C)(C)CCN1CCNC(F)(F)C1.
What is the InChIKey of 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine?
The InChIKey is YJNBDDJDQCZPJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2N2/c1-4-10(2,3)5-7-15-8-6-14-11(12,13)9-15/h14H,4-9H2,1-3H3.
What are the key properties of 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine?
1-(3,3-dimethylpentyl)-3,3-difluoropiperazine has a molecular weight of 220.31 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylpentyl)-3,3-difluoropiperazine is sourced from PubChem (CID 155118505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).