About 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol
1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol (PubChem CID 155118815) has the molecular formula C14H26F2O6
and a molecular weight of 328.35 g/mol. Its IUPAC name is 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol.
Molecular Properties
| Compound Name | 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol |
| PubChem CID | 155118815 |
| Molecular Formula | C14H26F2O6 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol |
| SMILES | C=CCOCCCCC(O)COCC(O)COCC(O)(F)F |
| InChI | InChI=1S/C14H26F2O6/c1-2-6-20-7-4-3-5-12(17)8-21-9-13(18)10-22-11-14(15,16)19/h2,12-13,17-19H,1,3-11H2 |
| InChIKey | UNXJJSMRTDAZLR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol?
The IUPAC name of 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol (CID 155118815) is 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol.
What is the SMILES notation for 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol?
The canonical SMILES for 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol is C=CCOCCCCC(O)COCC(O)COCC(O)(F)F.
What is the InChIKey of 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol?
The InChIKey is UNXJJSMRTDAZLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F2O6/c1-2-6-20-7-4-3-5-12(17)8-21-9-13(18)10-22-11-14(15,16)19/h2,12-13,17-19H,1,3-11H2.
What are the key properties of 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol?
1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol has a molecular weight of 328.35 g/mol, XLogP of 0.70, 15 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-6-prop-2-enoxyhexan-2-ol is sourced from PubChem (CID 155118815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).