About 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol
1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol (PubChem CID 155118932) has the molecular formula C13H24F2O7
and a molecular weight of 330.32 g/mol. Its IUPAC name is 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol.
Molecular Properties
| Compound Name | 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol |
| PubChem CID | 155118932 |
| Molecular Formula | C13H24F2O7 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol |
| SMILES | C=CCOCCOCC(O)COCC(O)COCC(O)(F)F |
| InChI | InChI=1S/C13H24F2O7/c1-2-3-19-4-5-20-6-11(16)7-21-8-12(17)9-22-10-13(14,15)18/h2,11-12,16-18H,1,3-10H2 |
| InChIKey | NOSXPLBUVYDOMQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol?
The IUPAC name of 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol (CID 155118932) is 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol.
What is the SMILES notation for 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol?
The canonical SMILES for 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol is C=CCOCCOCC(O)COCC(O)COCC(O)(F)F.
What is the InChIKey of 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol?
The InChIKey is NOSXPLBUVYDOMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24F2O7/c1-2-3-19-4-5-20-6-11(16)7-21-8-12(17)9-22-10-13(14,15)18/h2,11-12,16-18H,1,3-10H2.
What are the key properties of 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol?
1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol has a molecular weight of 330.32 g/mol, XLogP of -0.45, 15 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,2-difluoro-2-hydroxyethoxy)-2-hydroxypropoxy]-3-(2-prop-2-enoxyethoxy)propan-2-ol is sourced from PubChem (CID 155118932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).