About 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one
3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one (PubChem CID 155119057) has the molecular formula C15H12O4
and a molecular weight of 256.26 g/mol. Its IUPAC name is 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one.
Molecular Properties
| Compound Name | 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one |
| PubChem CID | 155119057 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one |
| SMILES | Cc1cc2c(cc1O)c(=O)oc1c(C)c(O)ccc12 |
| InChI | InChI=1S/C15H12O4/c1-7-5-10-9-3-4-12(16)8(2)14(9)19-15(18)11(10)6-13(7)17/h3-6,16-17H,1-2H3 |
| InChIKey | HTOXYAMXBPHKKF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one?
The IUPAC name of 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one (CID 155119057) is 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one.
What is the SMILES notation for 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one?
The canonical SMILES for 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one is Cc1cc2c(cc1O)c(=O)oc1c(C)c(O)ccc12.
What is the InChIKey of 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one?
The InChIKey is HTOXYAMXBPHKKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O4/c1-7-5-10-9-3-4-12(16)8(2)14(9)19-15(18)11(10)6-13(7)17/h3-6,16-17H,1-2H3.
What are the key properties of 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one?
3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one has a molecular weight of 256.26 g/mol, XLogP of 2.97, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dihydroxy-4,9-dimethylbenzo[c]chromen-6-one is sourced from PubChem (CID 155119057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).