C26H30ClF3N8O3 — CID 155119130
N-[3-chloro-4-[4-(piperidine-4-carbonyl)piperazine-1-carbonyl]phenyl]-1-methyl-5-[(3E)-4,4,4-trifluoro-3-hydrazinylidenebut-1-en-2-yl]imidazole-2-carboxamide (PubChem CID 155119130) has the molecular formula C26H30ClF3N8O3 and a molecular weight of 595.03 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(piperidine-4-carbonyl)piperazine-1-carbonyl]phenyl]-1-methyl-5-[(3E)-4,4,4-trifluoro-3-hydrazinylidenebut-1-en-2-yl]imidazole-2-carboxamide.
| Compound Name | N-[3-chloro-4-[4-(piperidine-4-carbonyl)piperazine-1-carbonyl]phenyl]-1-methyl-5-[(3E)-4,4,4-trifluoro-3-hydrazinylidenebut-1-en-2-yl]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 155119130 |
| Molecular Formula | C26H30ClF3N8O3 |
| Molecular Weight | 595.03 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | N-[3-chloro-4-[4-(piperidine-4-carbonyl)piperazine-1-carbonyl]phenyl]-1-methyl-5-[(3E)-4,4,4-trifluoro-3-hydrazinylidenebut-1-en-2-yl]imidazole-2-carboxamide |
| SMILES | C=C(/C(=N\N)C(F)(F)F)c1cnc(C(=O)Nc2ccc(C(=O)N3CCN(C(=O)C4CCNCC4)CC3)c(Cl)c2)n1C |
| InChI | InChI=1S/C26H30ClF3N8O3/c1-15(21(35-31)26(28,29)30)20-14-33-22(36(20)2)23(39)34-17-3-4-18(19(27)13-17)25(41)38-11-9-37(10-12-38)24(40)16-5-7-32-8-6-16/h3-4,13-14,16,32H,1,5-12,31H2,2H3,(H,34,39)/b35-21+ |
| InChIKey | HEUUPVLDMXNGGV-XICOUIIWSA-N |
| XLogP | 2.50 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.03 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|