About N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide
N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide (PubChem CID 155119204) has the molecular formula C20H30FNO5
and a molecular weight of 383.46 g/mol. Its IUPAC name is N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide.
Molecular Properties
| Compound Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide |
| PubChem CID | 155119204 |
| Molecular Formula | C20H30FNO5 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide |
| SMILES | CC(C)C1OC(CO)C(O)C(O)C1NC(=O)CCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H30FNO5/c1-12(2)20-17(19(26)18(25)15(11-23)27-20)22-16(24)6-4-3-5-13-7-9-14(21)10-8-13/h7-10,12,15,17-20,23,25-26H,3-6,11H2,1-2H3,(H,22,24) |
| InChIKey | ICSYMKCFHKDYCW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide?
The IUPAC name of N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide (CID 155119204) is N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide.
What is the SMILES notation for N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide?
The canonical SMILES for N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide is CC(C)C1OC(CO)C(O)C(O)C1NC(=O)CCCCc1ccc(F)cc1.
What is the InChIKey of N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide?
The InChIKey is ICSYMKCFHKDYCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30FNO5/c1-12(2)20-17(19(26)18(25)15(11-23)27-20)22-16(24)6-4-3-5-13-7-9-14(21)10-8-13/h7-10,12,15,17-20,23,25-26H,3-6,11H2,1-2H3,(H,22,24).
What are the key properties of N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide?
N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide has a molecular weight of 383.46 g/mol, XLogP of 1.16, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]-5-(4-fluorophenyl)pentanamide is sourced from PubChem (CID 155119204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).