About 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol
4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol (PubChem CID 155119528) has the molecular formula C12H12N2S4
and a molecular weight of 312.51 g/mol. Its IUPAC name is 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol.
Molecular Properties
| Compound Name | 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol |
| PubChem CID | 155119528 |
| Molecular Formula | C12H12N2S4 |
| Molecular Weight | 312.51 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol |
| SMILES | Sc1ccc(NNc2ccc(S)cc2S)c(S)c1 |
| InChI | InChI=1S/C12H12N2S4/c15-7-1-3-9(11(17)5-7)13-14-10-4-2-8(16)6-12(10)18/h1-6,13-18H |
| InChIKey | MCUXHLSPARJXFJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol?
The IUPAC name of 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol (CID 155119528) is 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol.
What is the SMILES notation for 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol?
The canonical SMILES for 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol is Sc1ccc(NNc2ccc(S)cc2S)c(S)c1.
What is the InChIKey of 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol?
The InChIKey is MCUXHLSPARJXFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2S4/c15-7-1-3-9(11(17)5-7)13-14-10-4-2-8(16)6-12(10)18/h1-6,13-18H.
What are the key properties of 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol?
4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol has a molecular weight of 312.51 g/mol, XLogP of 4.28, 3 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[2,4-bis(sulfanyl)phenyl]hydrazinyl]benzene-1,3-dithiol is sourced from PubChem (CID 155119528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).