C15H25FO3 — CID 155119673
(2E,4E)-4-[2-(2-fluoropropoxy)ethoxy]-3-methoxy-6-methylideneocta-2,4-diene (PubChem CID 155119673) has the molecular formula C15H25FO3 and a molecular weight of 272.36 g/mol. Its IUPAC name is (2E,4E)-4-[2-(2-fluoropropoxy)ethoxy]-3-methoxy-6-methylideneocta-2,4-diene.
| Compound Name | (2E,4E)-4-[2-(2-fluoropropoxy)ethoxy]-3-methoxy-6-methylideneocta-2,4-diene |
|---|---|
| PubChem CID | 155119673 |
| Molecular Formula | C15H25FO3 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (2E,4E)-4-[2-(2-fluoropropoxy)ethoxy]-3-methoxy-6-methylideneocta-2,4-diene |
| SMILES | C=C(/C=C(OCCOCC(C)F)\C(=C/C)OC)CC |
| InChI | InChI=1S/C15H25FO3/c1-6-12(3)10-15(14(7-2)17-5)19-9-8-18-11-13(4)16/h7,10,13H,3,6,8-9,11H2,1-2,4-5H3/b14-7+,15-10+ |
| InChIKey | XECHNRRWBWHTJB-IXQOFYBQSA-N |
| XLogP | 3.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|