About N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine
N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine (PubChem CID 155119717) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine.
Molecular Properties
| Compound Name | N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine |
| PubChem CID | 155119717 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine |
| SMILES | C=C(C)NOCCCC1C=CC=CC1 |
| InChI | InChI=1S/C12H19NO/c1-11(2)13-14-10-6-9-12-7-4-3-5-8-12/h3-5,7,12-13H,1,6,8-10H2,2H3 |
| InChIKey | VDZUKOFAYSMGGF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine?
The IUPAC name of N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine (CID 155119717) is N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine.
What is the SMILES notation for N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine?
The canonical SMILES for N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine is C=C(C)NOCCCC1C=CC=CC1.
What is the InChIKey of N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine?
The InChIKey is VDZUKOFAYSMGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-11(2)13-14-10-6-9-12-7-4-3-5-8-12/h3-5,7,12-13H,1,6,8-10H2,2H3.
What are the key properties of N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine?
N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine has a molecular weight of 193.29 g/mol, XLogP of 2.95, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyclohexa-2,4-dien-1-ylpropoxy)prop-1-en-2-amine is sourced from PubChem (CID 155119717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).