C35H47N3O2 — CID 155119951
N-[3-(1-cyclopropylpyrazol-4-yl)phenyl]-N-[[4-[(3Z)-5-methoxy-6-methylhepta-1,3,5-trien-2-yl]cyclohexyl]methyl]cyclohexanecarboxamide (PubChem CID 155119951) has the molecular formula C35H47N3O2 and a molecular weight of 541.78 g/mol. Its IUPAC name is N-[3-(1-cyclopropylpyrazol-4-yl)phenyl]-N-[[4-[(3Z)-5-methoxy-6-methylhepta-1,3,5-trien-2-yl]cyclohexyl]methyl]cyclohexanecarboxamide.
| Compound Name | N-[3-(1-cyclopropylpyrazol-4-yl)phenyl]-N-[[4-[(3Z)-5-methoxy-6-methylhepta-1,3,5-trien-2-yl]cyclohexyl]methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 155119951 |
| Molecular Formula | C35H47N3O2 |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.37 |
| IUPAC Name | N-[3-(1-cyclopropylpyrazol-4-yl)phenyl]-N-[[4-[(3Z)-5-methoxy-6-methylhepta-1,3,5-trien-2-yl]cyclohexyl]methyl]cyclohexanecarboxamide |
| SMILES | C=C(/C=C\C(OC)=C(C)C)C1CCC(CN(C(=O)C2CCCCC2)c2cccc(-c3cnn(C4CC4)c3)c2)CC1 |
| InChI | InChI=1S/C35H47N3O2/c1-25(2)34(40-4)20-13-26(3)28-16-14-27(15-17-28)23-37(35(39)29-9-6-5-7-10-29)33-12-8-11-30(21-33)31-22-36-38(24-31)32-18-19-32/h8,11-13,20-22,24,27-29,32H,3,5-7,9-10,14-19,23H2,1-2,4H3/b20-13- |
| InChIKey | VAJIXAVAWROPRN-MOSHPQCFSA-N |
| XLogP | 8.66 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|