C22H26F9N3O3 — CID 155120501
1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-hydroxyethylamino)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 155120501) has the molecular formula C22H26F9N3O3 and a molecular weight of 551.45 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-hydroxyethylamino)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-hydroxyethylamino)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 155120501 |
| Molecular Formula | C22H26F9N3O3 |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[[2-(2-hydroxyethylamino)-4-(trifluoromethyl)phenyl]methyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CCCN2Cc2ccc(C(F)(F)F)cc2NCCO)CC1 |
| InChI | InChI=1S/C22H26F9N3O3/c23-20(24,25)15-3-2-14(16(12-15)32-7-11-35)13-34-8-1-4-19(34)5-9-33(10-6-19)18(36)37-17(21(26,27)28)22(29,30)31/h2-3,12,17,32,35H,1,4-11,13H2 |
| InChIKey | LTYBVSFDXFHWPP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |