C36H66N8O6 — CID 155120870
(3S,6S,9S,12S,15S)-3-[(3-aminocyclobutyl)oxymethyl]-6-(aminomethyl)-9-cyclohexyl-16-hexyl-13,15-dimethyl-12-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone (PubChem CID 155120870) has the molecular formula C36H66N8O6 and a molecular weight of 706.97 g/mol. Its IUPAC name is (3S,6S,9S,12S,15S)-3-[(3-aminocyclobutyl)oxymethyl]-6-(aminomethyl)-9-cyclohexyl-16-hexyl-13,15-dimethyl-12-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone.
| Compound Name | (3S,6S,9S,12S,15S)-3-[(3-aminocyclobutyl)oxymethyl]-6-(aminomethyl)-9-cyclohexyl-16-hexyl-13,15-dimethyl-12-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 155120870 |
| Molecular Formula | C36H66N8O6 |
| Molecular Weight | 706.97 g/mol |
| Exact Mass | 706.51 |
| IUPAC Name | (3S,6S,9S,12S,15S)-3-[(3-aminocyclobutyl)oxymethyl]-6-(aminomethyl)-9-cyclohexyl-16-hexyl-13,15-dimethyl-12-(2-methylpropyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone |
| SMILES | CCCCCCN1CCNC(=O)[C@H](COC2CC(N)C2)NC(=O)[C@H](CN)NC(=O)[C@H](C2CCCCC2)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C36H66N8O6/c1-6-7-8-12-16-44-17-15-39-32(45)29(22-50-27-19-26(38)20-27)41-33(46)28(21-37)40-35(48)31(25-13-10-9-11-14-25)42-34(47)30(18-23(2)3)43(5)36(49)24(44)4/h23-31H,6-22,37-38H2,1-5H3,(H,39,45)(H,40,48)(H,41,46)(H,42,47)/t24-,26?,27?,28-,29-,30-,31-/m0/s1 |
| InChIKey | ORNMZBJQFVLHDB-WRFYLDMTSA-N |
| XLogP | 0.76 |
| TPSA | 201.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.97 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|