C19H25NO3 — CID 155121447
(1R,4aS,8aR)-4a-(3-hydroxy-2-methoxy-6-methylphenyl)-1,2-dimethyl-3,4,5,8a-tetrahydro-1H-isoquinolin-6-one (PubChem CID 155121447) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (1R,4aS,8aR)-4a-(3-hydroxy-2-methoxy-6-methylphenyl)-1,2-dimethyl-3,4,5,8a-tetrahydro-1H-isoquinolin-6-one.
| Compound Name | (1R,4aS,8aR)-4a-(3-hydroxy-2-methoxy-6-methylphenyl)-1,2-dimethyl-3,4,5,8a-tetrahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 155121447 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (1R,4aS,8aR)-4a-(3-hydroxy-2-methoxy-6-methylphenyl)-1,2-dimethyl-3,4,5,8a-tetrahydro-1H-isoquinolin-6-one |
| SMILES | COc1c(O)ccc(C)c1[C@]12CCN(C)[C@H](C)[C@@H]1C=CC(=O)C2 |
| InChI | InChI=1S/C19H25NO3/c1-12-5-8-16(22)18(23-4)17(12)19-9-10-20(3)13(2)15(19)7-6-14(21)11-19/h5-8,13,15,22H,9-11H2,1-4H3/t13-,15+,19+/m1/s1 |
| InChIKey | CCGJCHDZDOMYJV-WTANOLMUSA-N |
| XLogP | 2.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |