C9H14O5 — CID 15512153
(3aS,7R,7aS)-7-methoxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one (PubChem CID 15512153) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is (3aS,7R,7aS)-7-methoxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one.
| Compound Name | (3aS,7R,7aS)-7-methoxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one |
|---|---|
| PubChem CID | 15512153 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (3aS,7R,7aS)-7-methoxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one |
| SMILES | CO[C@H]1C(=O)OC[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C9H14O5/c1-9(2)13-5-4-12-8(10)7(11-3)6(5)14-9/h5-7H,4H2,1-3H3/t5-,6-,7+/m0/s1 |
| InChIKey | ODCKSMGJKRXUOK-LYFYHCNISA-N |
| XLogP | 0.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |