C17H37N3S — CID 155121856
1-[2,2,4,4,6,6-hexamethyl-3,5-di(propan-2-yl)-1,3,5-triazinan-1-yl]ethanethiol (PubChem CID 155121856) has the molecular formula C17H37N3S and a molecular weight of 315.57 g/mol. Its IUPAC name is 1-[2,2,4,4,6,6-hexamethyl-3,5-di(propan-2-yl)-1,3,5-triazinan-1-yl]ethanethiol.
| Compound Name | 1-[2,2,4,4,6,6-hexamethyl-3,5-di(propan-2-yl)-1,3,5-triazinan-1-yl]ethanethiol |
|---|---|
| PubChem CID | 155121856 |
| Molecular Formula | C17H37N3S |
| Molecular Weight | 315.57 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | 1-[2,2,4,4,6,6-hexamethyl-3,5-di(propan-2-yl)-1,3,5-triazinan-1-yl]ethanethiol |
| SMILES | CC(C)N1C(C)(C)N(C(C)C)C(C)(C)N(C(C)S)C1(C)C |
| InChI | InChI=1S/C17H37N3S/c1-12(2)18-15(6,7)19(13(3)4)17(10,11)20(14(5)21)16(18,8)9/h12-14,21H,1-11H3 |
| InChIKey | OLNOQLWDRXVWBV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|