About 5,7-dichloro-1,2-dimethylindole
5,7-dichloro-1,2-dimethylindole (PubChem CID 155122072) has the molecular formula C10H9Cl2N
and a molecular weight of 214.09 g/mol. Its IUPAC name is 5,7-dichloro-1,2-dimethylindole.
Molecular Properties
| Compound Name | 5,7-dichloro-1,2-dimethylindole |
| PubChem CID | 155122072 |
| Molecular Formula | C10H9Cl2N |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 5,7-dichloro-1,2-dimethylindole |
| SMILES | Cc1cc2cc(Cl)cc(Cl)c2n1C |
| InChI | InChI=1S/C10H9Cl2N/c1-6-3-7-4-8(11)5-9(12)10(7)13(6)2/h3-5H,1-2H3 |
| InChIKey | FXOHZSBTTOEGKF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,7-dichloro-1,2-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-1,2-dimethylindole?
The IUPAC name of 5,7-dichloro-1,2-dimethylindole (CID 155122072) is 5,7-dichloro-1,2-dimethylindole.
What is the SMILES notation for 5,7-dichloro-1,2-dimethylindole?
The canonical SMILES for 5,7-dichloro-1,2-dimethylindole is Cc1cc2cc(Cl)cc(Cl)c2n1C.
What is the InChIKey of 5,7-dichloro-1,2-dimethylindole?
The InChIKey is FXOHZSBTTOEGKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2N/c1-6-3-7-4-8(11)5-9(12)10(7)13(6)2/h3-5H,1-2H3.
What are the key properties of 5,7-dichloro-1,2-dimethylindole?
5,7-dichloro-1,2-dimethylindole has a molecular weight of 214.09 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-1,2-dimethylindole is sourced from PubChem (CID 155122072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).