C46H71N3O9 — CID 155122175
(2Z)-2-[2-[3-[[(Z)-4-butyl-3-carboxyoct-2-enoyl]amino]-5-[[(Z)-3-carboxynon-2-enoyl]amino]anilino]-2-oxoethylidene]-3-hexylnonanoic acid (PubChem CID 155122175) has the molecular formula C46H71N3O9 and a molecular weight of 810.09 g/mol. Its IUPAC name is (2Z)-2-[2-[3-[[(Z)-4-butyl-3-carboxyoct-2-enoyl]amino]-5-[[(Z)-3-carboxynon-2-enoyl]amino]anilino]-2-oxoethylidene]-3-hexylnonanoic acid.
| Compound Name | (2Z)-2-[2-[3-[[(Z)-4-butyl-3-carboxyoct-2-enoyl]amino]-5-[[(Z)-3-carboxynon-2-enoyl]amino]anilino]-2-oxoethylidene]-3-hexylnonanoic acid |
|---|---|
| PubChem CID | 155122175 |
| Molecular Formula | C46H71N3O9 |
| Molecular Weight | 810.09 g/mol |
| Exact Mass | 809.52 |
| IUPAC Name | (2Z)-2-[2-[3-[[(Z)-4-butyl-3-carboxyoct-2-enoyl]amino]-5-[[(Z)-3-carboxynon-2-enoyl]amino]anilino]-2-oxoethylidene]-3-hexylnonanoic acid |
| SMILES | CCCCCC/C(=C/C(=O)Nc1cc(NC(=O)/C=C(\C(=O)O)C(CCCC)CCCC)cc(NC(=O)/C=C(\C(=O)O)C(CCCCCC)CCCCCC)c1)C(=O)O |
| InChI | InChI=1S/C46H71N3O9/c1-6-11-16-19-24-34(25-20-17-12-7-2)40(46(57)58)32-43(52)49-38-29-36(47-41(50)27-35(44(53)54)26-21-18-13-8-3)28-37(30-38)48-42(51)31-39(45(55)56)33(22-14-9-4)23-15-10-5/h27-34H,6-26H2,1-5H3,(H,47,50)(H,48,51)(H,49,52)(H,53,54)(H,55,56)(H,57,58)/b35-27-,39-31-,40-32- |
| InChIKey | ZLSGRBWXCMQATG-FXTQWVACSA-N |
| XLogP | 11.06 |
| TPSA | 199.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.09 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|