C13H9F5N2O3S — CID 15512246
N-(3-amino-4-methoxyphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide (PubChem CID 15512246) has the molecular formula C13H9F5N2O3S and a molecular weight of 368.28 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 15512246 |
| Molecular Formula | C13H9F5N2O3S |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1N |
| InChI | InChI=1S/C13H9F5N2O3S/c1-23-7-3-2-5(4-6(7)19)20-24(21,22)13-11(17)9(15)8(14)10(16)12(13)18/h2-4,20H,19H2,1H3 |
| InChIKey | ZALDJOGOCXZDSV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|