C22H29N3O5 — CID 155123427
3-[4-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]phenoxy]cyclohexane-1-carboxylic acid (PubChem CID 155123427) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-[4-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]phenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[4-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]phenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155123427 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 3-[4-[1-methyl-5-(oxan-2-yloxymethyl)triazol-4-yl]phenoxy]cyclohexane-1-carboxylic acid |
| SMILES | Cn1nnc(-c2ccc(OC3CCCC(C(=O)O)C3)cc2)c1COC1CCCCO1 |
| InChI | InChI=1S/C22H29N3O5/c1-25-19(14-29-20-7-2-3-12-28-20)21(23-24-25)15-8-10-17(11-9-15)30-18-6-4-5-16(13-18)22(26)27/h8-11,16,18,20H,2-7,12-14H2,1H3,(H,26,27) |
| InChIKey | PLQUJFSUWRVWSQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |