About 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one
4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one (PubChem CID 15512391) has the molecular formula C18H24ClNO2
and a molecular weight of 321.85 g/mol. Its IUPAC name is 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one.
Molecular Properties
| Compound Name | 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one |
| PubChem CID | 15512391 |
| Molecular Formula | C18H24ClNO2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one |
| SMILES | CC1(C)COC(C(C)(C)c2ccc(C(=O)CCCCl)cc2)=N1 |
| InChI | InChI=1S/C18H24ClNO2/c1-17(2)12-22-16(20-17)18(3,4)14-9-7-13(8-10-14)15(21)6-5-11-19/h7-10H,5-6,11-12H2,1-4H3 |
| InChIKey | ARWJPQLTIQHROS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one?
The IUPAC name of 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one (CID 15512391) is 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one.
What is the SMILES notation for 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one?
The canonical SMILES for 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one is CC1(C)COC(C(C)(C)c2ccc(C(=O)CCCCl)cc2)=N1.
What is the InChIKey of 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one?
The InChIKey is ARWJPQLTIQHROS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24ClNO2/c1-17(2)12-22-16(20-17)18(3,4)14-9-7-13(8-10-14)15(21)6-5-11-19/h7-10H,5-6,11-12H2,1-4H3.
What are the key properties of 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one?
4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one has a molecular weight of 321.85 g/mol, XLogP of 4.37, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]butan-1-one is sourced from PubChem (CID 15512391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).