About ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate
ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate (PubChem CID 15512410) has the molecular formula C10H17F3O5S
and a molecular weight of 306.30 g/mol. Its IUPAC name is ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate.
Molecular Properties
| Compound Name | ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate |
| PubChem CID | 15512410 |
| Molecular Formula | C10H17F3O5S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate |
| SMILES | CCOC(=O)C(CC(F)(F)F)C(CC)OS(C)(=O)=O |
| InChI | InChI=1S/C10H17F3O5S/c1-4-8(18-19(3,15)16)7(6-10(11,12)13)9(14)17-5-2/h7-8H,4-6H2,1-3H3 |
| InChIKey | ZOCLANCYQNKCQW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate?
The IUPAC name of ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate (CID 15512410) is ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate.
What is the SMILES notation for ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate?
The canonical SMILES for ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate is CCOC(=O)C(CC(F)(F)F)C(CC)OS(C)(=O)=O.
What is the InChIKey of ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate?
The InChIKey is ZOCLANCYQNKCQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3O5S/c1-4-8(18-19(3,15)16)7(6-10(11,12)13)9(14)17-5-2/h7-8H,4-6H2,1-3H3.
What are the key properties of ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate?
ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate has a molecular weight of 306.30 g/mol, XLogP of 1.87, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methylsulfonyloxy-2-(2,2,2-trifluoroethyl)pentanoate is sourced from PubChem (CID 15512410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).