C34H39F3N4O4S — CID 155124139
3-[3-(3-aminopropylamino)-1-[3-(trifluoromethoxy)phenyl]propyl]-1-cyclohexylindole-5-carbonitrile;benzenesulfonic acid (PubChem CID 155124139) has the molecular formula C34H39F3N4O4S and a molecular weight of 656.77 g/mol. Its IUPAC name is 3-[3-(3-aminopropylamino)-1-[3-(trifluoromethoxy)phenyl]propyl]-1-cyclohexylindole-5-carbonitrile;benzenesulfonic acid.
| Compound Name | 3-[3-(3-aminopropylamino)-1-[3-(trifluoromethoxy)phenyl]propyl]-1-cyclohexylindole-5-carbonitrile;benzenesulfonic acid |
|---|---|
| PubChem CID | 155124139 |
| Molecular Formula | C34H39F3N4O4S |
| Molecular Weight | 656.77 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | 3-[3-(3-aminopropylamino)-1-[3-(trifluoromethoxy)phenyl]propyl]-1-cyclohexylindole-5-carbonitrile;benzenesulfonic acid |
| SMILES | N#Cc1ccc2c(c1)c(C(CCNCCCN)c1cccc(OC(F)(F)F)c1)cn2C1CCCCC1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C28H33F3N4O.C6H6O3S/c29-28(30,31)36-23-9-4-6-21(17-23)24(12-15-34-14-5-13-32)26-19-35(22-7-2-1-3-8-22)27-11-10-20(18-33)16-25(26)27;7-10(8,9)6-4-2-1-3-5-6/h4,6,9-11,16-17,19,22,24,34H,1-3,5,7-8,12-15,32H2;1-5H,(H,7,8,9) |
| InChIKey | UNAIDIPEOWNFDF-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 130.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.77 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|