C75H85ClN2 — CID 155124334
7,9-bis[2,6-bis[1-(3,5-diethylphenyl)ethyl]-4-methylphenyl]acenaphthyleno[1,2-d]imidazol-9-ium chloride (PubChem CID 155124334) has the molecular formula C75H85ClN2 and a molecular weight of 1049.97 g/mol. Its IUPAC name is 7,9-bis[2,6-bis[1-(3,5-diethylphenyl)ethyl]-4-methylphenyl]acenaphthyleno[1,2-d]imidazol-9-ium chloride.
| Compound Name | 7,9-bis[2,6-bis[1-(3,5-diethylphenyl)ethyl]-4-methylphenyl]acenaphthyleno[1,2-d]imidazol-9-ium chloride |
|---|---|
| PubChem CID | 155124334 |
| Molecular Formula | C75H85ClN2 |
| Molecular Weight | 1049.97 g/mol |
| Exact Mass | 1048.64 |
| IUPAC Name | 7,9-bis[2,6-bis[1-(3,5-diethylphenyl)ethyl]-4-methylphenyl]acenaphthyleno[1,2-d]imidazol-9-ium chloride |
| SMILES | CCc1cc(CC)cc(C(C)c2cc(C)cc(C(C)c3cc(CC)cc(CC)c3)c2-n2c[n+](-c3c(C(C)c4cc(CC)cc(CC)c4)cc(C)cc3C(C)c3cc(CC)cc(CC)c3)c3c2-c2cccc4cccc-3c24)c1.[Cl-] |
| InChI | InChI=1S/C75H85N2.ClH/c1-15-52-33-53(16-2)38-61(37-52)48(11)67-29-46(9)30-68(49(12)62-39-54(17-3)34-55(18-4)40-62)72(67)76-45-77(75-66-28-24-26-60-25-23-27-65(71(60)66)74(75)76)73-69(50(13)63-41-56(19-5)35-57(20-6)42-63)31-47(10)32-70(73)51(14)64-43-58(21-7)36-59(22-8)44-64;/h23-45,48-51H,15-22H2,1-14H3;1H/q+1;/p-1 |
| InChIKey | BKCFBJNBGLTLOW-UHFFFAOYSA-M |
| XLogP | 16.28 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.97 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|