C59H53N2+ — CID 155124353
7,9-bis[4-methyl-2,6-bis(1-phenylethyl)phenyl]acenaphthyleno[1,2-d]imidazol-9-ium (PubChem CID 155124353) has the molecular formula C59H53N2+ and a molecular weight of 790.09 g/mol. Its IUPAC name is 7,9-bis[4-methyl-2,6-bis(1-phenylethyl)phenyl]acenaphthyleno[1,2-d]imidazol-9-ium.
| Compound Name | 7,9-bis[4-methyl-2,6-bis(1-phenylethyl)phenyl]acenaphthyleno[1,2-d]imidazol-9-ium |
|---|---|
| PubChem CID | 155124353 |
| Molecular Formula | C59H53N2+ |
| Molecular Weight | 790.09 g/mol |
| Exact Mass | 789.42 |
| IUPAC Name | 7,9-bis[4-methyl-2,6-bis(1-phenylethyl)phenyl]acenaphthyleno[1,2-d]imidazol-9-ium |
| SMILES | Cc1cc(C(C)c2ccccc2)c(-n2c[n+](-c3c(C(C)c4ccccc4)cc(C)cc3C(C)c3ccccc3)c3c2-c2cccc4cccc-3c24)c(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C59H53N2/c1-38-33-51(40(3)44-21-11-7-12-22-44)56(52(34-38)41(4)45-23-13-8-14-24-45)60-37-61(59-50-32-20-30-48-29-19-31-49(55(48)50)58(59)60)57-53(42(5)46-25-15-9-16-26-46)35-39(2)36-54(57)43(6)47-27-17-10-18-28-47/h7-37,40-43H,1-6H3/q+1 |
| InChIKey | RZFQFKRBVDVPTR-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.09 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|