C36H30Cl2N6O6S — CID 155124921
6-chloro-2-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-N-[3-nitro-4-(2-pyridin-4-ylethylamino)phenyl]sulfonylindazole-3-carboxamide (PubChem CID 155124921) has the molecular formula C36H30Cl2N6O6S and a molecular weight of 745.64 g/mol. Its IUPAC name is 6-chloro-2-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-N-[3-nitro-4-(2-pyridin-4-ylethylamino)phenyl]sulfonylindazole-3-carboxamide.
| Compound Name | 6-chloro-2-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-N-[3-nitro-4-(2-pyridin-4-ylethylamino)phenyl]sulfonylindazole-3-carboxamide |
|---|---|
| PubChem CID | 155124921 |
| Molecular Formula | C36H30Cl2N6O6S |
| Molecular Weight | 745.64 g/mol |
| Exact Mass | 744.13 |
| IUPAC Name | 6-chloro-2-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-N-[3-nitro-4-(2-pyridin-4-ylethylamino)phenyl]sulfonylindazole-3-carboxamide |
| SMILES | Cc1cc(Oc2ccc(Cn3nc4cc(Cl)ccc4c3C(=O)NS(=O)(=O)c3ccc(NCCc4ccncc4)c([N+](=O)[O-])c3)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C36H30Cl2N6O6S/c1-22-17-28(18-23(2)34(22)38)50-27-6-3-25(4-7-27)21-43-35(30-9-5-26(37)19-32(30)41-43)36(45)42-51(48,49)29-8-10-31(33(20-29)44(46)47)40-16-13-24-11-14-39-15-12-24/h3-12,14-15,17-20,40H,13,16,21H2,1-2H3,(H,42,45) |
| InChIKey | DXZPZUFWWVQCSK-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.64 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|