About [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate
[cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate (PubChem CID 155125456) has the molecular formula C19H25N5O6S
and a molecular weight of 451.51 g/mol. Its IUPAC name is [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate.
Molecular Properties
| Compound Name | [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate |
| PubChem CID | 155125456 |
| Molecular Formula | C19H25N5O6S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate |
| SMILES | COc1cc2ncnc(N3CCC(N(C4CC4)S(=O)(=O)OC(N)=O)CC3)c2cc1OC |
| InChI | InChI=1S/C19H25N5O6S/c1-28-16-9-14-15(10-17(16)29-2)21-11-22-18(14)23-7-5-13(6-8-23)24(12-3-4-12)31(26,27)30-19(20)25/h9-13H,3-8H2,1-2H3,(H2,20,25) |
| InChIKey | OSCVHNHZUVCMJT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate?
The IUPAC name of [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate (CID 155125456) is [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate.
What is the SMILES notation for [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate?
The canonical SMILES for [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate is COc1cc2ncnc(N3CCC(N(C4CC4)S(=O)(=O)OC(N)=O)CC3)c2cc1OC.
What is the InChIKey of [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate?
The InChIKey is OSCVHNHZUVCMJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5O6S/c1-28-16-9-14-15(10-17(16)29-2)21-11-22-18(14)23-7-5-13(6-8-23)24(12-3-4-12)31(26,27)30-19(20)25/h9-13H,3-8H2,1-2H3,(H2,20,25).
What are the key properties of [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate?
[cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate has a molecular weight of 451.51 g/mol, XLogP of 1.42, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclopropyl-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]sulfamoyl] carbamate is sourced from PubChem (CID 155125456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).