About 10H-phenoxazine;N-phenylphenoxazin-3-imine
10H-phenoxazine;N-phenylphenoxazin-3-imine (PubChem CID 155125781) has the molecular formula C30H21N3O2
and a molecular weight of 455.52 g/mol. Its IUPAC name is 10H-phenoxazine;N-phenylphenoxazin-3-imine.
Molecular Properties
| Compound Name | 10H-phenoxazine;N-phenylphenoxazin-3-imine |
| PubChem CID | 155125781 |
| Molecular Formula | C30H21N3O2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 10H-phenoxazine;N-phenylphenoxazin-3-imine |
| SMILES | c1ccc(/N=c2\ccc3nc4ccccc4oc-3c2)cc1.c1ccc2c(c1)Nc1ccccc1O2 |
| InChI | InChI=1S/C18H12N2O.C12H9NO/c1-2-6-13(7-3-1)19-14-10-11-16-18(12-14)21-17-9-5-4-8-15(17)20-16;1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-12H;1-8,13H/b19-14+; |
| InChIKey | DVLLNIRRWIZFSX-UGAWPWHASA-N |
| XLogP | 7.70 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 10H-phenoxazine;N-phenylphenoxazin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-phenoxazine;N-phenylphenoxazin-3-imine?
The IUPAC name of 10H-phenoxazine;N-phenylphenoxazin-3-imine (CID 155125781) is 10H-phenoxazine;N-phenylphenoxazin-3-imine.
What is the SMILES notation for 10H-phenoxazine;N-phenylphenoxazin-3-imine?
The canonical SMILES for 10H-phenoxazine;N-phenylphenoxazin-3-imine is c1ccc(/N=c2\ccc3nc4ccccc4oc-3c2)cc1.c1ccc2c(c1)Nc1ccccc1O2.
What is the InChIKey of 10H-phenoxazine;N-phenylphenoxazin-3-imine?
The InChIKey is DVLLNIRRWIZFSX-UGAWPWHASA-N. The full InChI is InChI=1S/C18H12N2O.C12H9NO/c1-2-6-13(7-3-1)19-14-10-11-16-18(12-14)21-17-9-5-4-8-15(17)20-16;1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-12H;1-8,13H/b19-14+;.
What are the key properties of 10H-phenoxazine;N-phenylphenoxazin-3-imine?
10H-phenoxazine;N-phenylphenoxazin-3-imine has a molecular weight of 455.52 g/mol, XLogP of 7.70, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-phenoxazine;N-phenylphenoxazin-3-imine is sourced from PubChem (CID 155125781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).