C21H23ClN4O3S — CID 15512592
ethyl 3-[(3-chloro-4-methoxyphenyl)methylamino]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-5-carboxylate (PubChem CID 15512592) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol. Its IUPAC name is ethyl 3-[(3-chloro-4-methoxyphenyl)methylamino]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-5-carboxylate.
| Compound Name | ethyl 3-[(3-chloro-4-methoxyphenyl)methylamino]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 15512592 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | ethyl 3-[(3-chloro-4-methoxyphenyl)methylamino]-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-5-carboxylate |
| SMILES | CCOC(=O)c1nc(NCc2ccc(OC)c(Cl)c2)c2c3c(sc2n1)CN(C)CC3 |
| InChI | InChI=1S/C21H23ClN4O3S/c1-4-29-21(27)19-24-18(23-10-12-5-6-15(28-3)14(22)9-12)17-13-7-8-26(2)11-16(13)30-20(17)25-19/h5-6,9H,4,7-8,10-11H2,1-3H3,(H,23,24,25) |
| InChIKey | NTZVARMTBDWJNB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |