C20H32O2 — CID 155126102
(1R,3S,5R,7R,8R,10S,13R)-5,7,9,9,13-pentamethyl-5-[(E)-prop-1-enyl]-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane (PubChem CID 155126102) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,3S,5R,7R,8R,10S,13R)-5,7,9,9,13-pentamethyl-5-[(E)-prop-1-enyl]-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane.
| Compound Name | (1R,3S,5R,7R,8R,10S,13R)-5,7,9,9,13-pentamethyl-5-[(E)-prop-1-enyl]-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
|---|---|
| PubChem CID | 155126102 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,3S,5R,7R,8R,10S,13R)-5,7,9,9,13-pentamethyl-5-[(E)-prop-1-enyl]-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
| SMILES | C/C=C/[C@]1(C)O[C@H]2C[C@@]34C[C@H](C(C)(C)[C@@H]3CC[C@H]4C)[C@@]2(C)O1 |
| InChI | InChI=1S/C20H32O2/c1-7-10-18(5)21-16-12-20-11-15(19(16,6)22-18)17(3,4)14(20)9-8-13(20)2/h7,10,13-16H,8-9,11-12H2,1-6H3/b10-7+/t13-,14+,15-,16+,18-,19-,20-/m1/s1 |
| InChIKey | BELAANNSEZRXFR-LDGQGMFRSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|