C29H25ClF9N5O3 — CID 155126612
8-[2-amino-6-[1-[2-[3,5-bis(trifluoromethyl)phenyl]-4-chlorophenyl]-2,2,2-trifluoroethoxy]pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-3-carboxylic acid (PubChem CID 155126612) has the molecular formula C29H25ClF9N5O3 and a molecular weight of 697.99 g/mol. Its IUPAC name is 8-[2-amino-6-[1-[2-[3,5-bis(trifluoromethyl)phenyl]-4-chlorophenyl]-2,2,2-trifluoroethoxy]pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-3-carboxylic acid.
| Compound Name | 8-[2-amino-6-[1-[2-[3,5-bis(trifluoromethyl)phenyl]-4-chlorophenyl]-2,2,2-trifluoroethoxy]pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 155126612 |
| Molecular Formula | C29H25ClF9N5O3 |
| Molecular Weight | 697.99 g/mol |
| Exact Mass | 697.15 |
| IUPAC Name | 8-[2-amino-6-[1-[2-[3,5-bis(trifluoromethyl)phenyl]-4-chlorophenyl]-2,2,2-trifluoroethoxy]pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-3-carboxylic acid |
| SMILES | Nc1nc(OC(c2ccc(Cl)cc2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(F)(F)F)cc(N2CCC3(CC2)CNC(C(=O)O)C3)n1 |
| InChI | InChI=1S/C29H25ClF9N5O3/c30-17-1-2-18(19(10-17)14-7-15(27(31,32)33)9-16(8-14)28(34,35)36)23(29(37,38)39)47-22-11-21(42-25(40)43-22)44-5-3-26(4-6-44)12-20(24(45)46)41-13-26/h1-2,7-11,20,23,41H,3-6,12-13H2,(H,45,46)(H2,40,42,43) |
| InChIKey | AHSCXUZRPUVOGT-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.99 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |