C22H29N3O — CID 155126723
2-phenyl-4-(2,4,4-trimethylpentan-2-yl)phenol;2H-triazole (PubChem CID 155126723) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-phenyl-4-(2,4,4-trimethylpentan-2-yl)phenol;2H-triazole.
| Compound Name | 2-phenyl-4-(2,4,4-trimethylpentan-2-yl)phenol;2H-triazole |
|---|---|
| PubChem CID | 155126723 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-phenyl-4-(2,4,4-trimethylpentan-2-yl)phenol;2H-triazole |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(-c2ccccc2)c1.c1cn[nH]n1 |
| InChI | InChI=1S/C20H26O.C2H3N3/c1-19(2,3)14-20(4,5)16-11-12-18(21)17(13-16)15-9-7-6-8-10-15;1-2-4-5-3-1/h6-13,21H,14H2,1-5H3;1-2H,(H,3,4,5) |
| InChIKey | NJBQJOUYTGHSHT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |