C18H14BrCl2N5OS — CID 155126846
3-[3-bromo-4-chloro-2-methyl-6-(methylcarbamothioyl)phenyl]-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxamide (PubChem CID 155126846) has the molecular formula C18H14BrCl2N5OS and a molecular weight of 499.22 g/mol. Its IUPAC name is 3-[3-bromo-4-chloro-2-methyl-6-(methylcarbamothioyl)phenyl]-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxamide.
| Compound Name | 3-[3-bromo-4-chloro-2-methyl-6-(methylcarbamothioyl)phenyl]-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 155126846 |
| Molecular Formula | C18H14BrCl2N5OS |
| Molecular Weight | 499.22 g/mol |
| Exact Mass | 496.95 |
| IUPAC Name | 3-[3-bromo-4-chloro-2-methyl-6-(methylcarbamothioyl)phenyl]-1-(3-chloro-2-pyridinyl)pyrazole-5-carboxamide |
| SMILES | CNC(=S)c1cc(Cl)c(Br)c(C)c1-c1cc(C(N)=O)n(-c2ncccc2Cl)n1 |
| InChI | InChI=1S/C18H14BrCl2N5OS/c1-8-14(9(18(28)23-2)6-11(21)15(8)19)12-7-13(16(22)27)26(25-12)17-10(20)4-3-5-24-17/h3-7H,1-2H3,(H2,22,27)(H,23,28) |
| InChIKey | YCYVMEBONOYCNH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|