C13H18F2N2O — CID 155127158
(S)-(4-amino-3,5-difluorophenyl)-[(2R)-5,5-dimethylpyrrolidin-2-yl]methanol (PubChem CID 155127158) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is (S)-(4-amino-3,5-difluorophenyl)-[(2R)-5,5-dimethylpyrrolidin-2-yl]methanol.
| Compound Name | (S)-(4-amino-3,5-difluorophenyl)-[(2R)-5,5-dimethylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 155127158 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (S)-(4-amino-3,5-difluorophenyl)-[(2R)-5,5-dimethylpyrrolidin-2-yl]methanol |
| SMILES | CC1(C)CC[C@H]([C@@H](O)c2cc(F)c(N)c(F)c2)N1 |
| InChI | InChI=1S/C13H18F2N2O/c1-13(2)4-3-10(17-13)12(18)7-5-8(14)11(16)9(15)6-7/h5-6,10,12,17-18H,3-4,16H2,1-2H3/t10-,12+/m1/s1 |
| InChIKey | SMZNOAPTAPQJFA-PWSUYJOCSA-N |
| XLogP | 2.11 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|