About (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride
(S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride (PubChem CID 155127632) has the molecular formula C11H17Cl2FN2O
and a molecular weight of 283.17 g/mol. Its IUPAC name is (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride.
Molecular Properties
| Compound Name | (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride |
| PubChem CID | 155127632 |
| Molecular Formula | C11H17Cl2FN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride |
| SMILES | CC1(C)CC([C@@H](O)c2cncc(F)c2)N1.Cl.Cl |
| InChI | InChI=1S/C11H15FN2O.2ClH/c1-11(2)4-9(14-11)10(15)7-3-8(12)6-13-5-7;;/h3,5-6,9-10,14-15H,4H2,1-2H3;2*1H/t9?,10-;;/m0../s1 |
| InChIKey | YGKMONXHTUBEHE-NYMKFKOJSA-N |
| XLogP | 2.24 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride?
The IUPAC name of (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride (CID 155127632) is (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride.
What is the SMILES notation for (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride?
The canonical SMILES for (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride is CC1(C)CC([C@@H](O)c2cncc(F)c2)N1.Cl.Cl.
What is the InChIKey of (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride?
The InChIKey is YGKMONXHTUBEHE-NYMKFKOJSA-N. The full InChI is InChI=1S/C11H15FN2O.2ClH/c1-11(2)4-9(14-11)10(15)7-3-8(12)6-13-5-7;;/h3,5-6,9-10,14-15H,4H2,1-2H3;2*1H/t9?,10-;;/m0../s1.
What are the key properties of (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride?
(S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride has a molecular weight of 283.17 g/mol, XLogP of 2.24, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(4,4-dimethylazetidin-2-yl)-(5-fluoro-3-pyridinyl)methanol;dihydrochloride is sourced from PubChem (CID 155127632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).