About (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine
(3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine (PubChem CID 155128113) has the molecular formula C9H9ClFNO
and a molecular weight of 201.63 g/mol. Its IUPAC name is (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine.
Molecular Properties
| Compound Name | (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine |
| PubChem CID | 155128113 |
| Molecular Formula | C9H9ClFNO |
| Molecular Weight | 201.63 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine |
| SMILES | Fc1cc(Cl)cc([C@H]2CCON2)c1 |
| InChI | InChI=1S/C9H9ClFNO/c10-7-3-6(4-8(11)5-7)9-1-2-13-12-9/h3-5,9,12H,1-2H2/t9-/m1/s1 |
| InChIKey | LYUKOXZGVVRESV-SECBINFHSA-N |
| XLogP | 2.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.63 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine?
The IUPAC name of (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine (CID 155128113) is (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine.
What is the SMILES notation for (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine?
The canonical SMILES for (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine is Fc1cc(Cl)cc([C@H]2CCON2)c1.
What is the InChIKey of (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine?
The InChIKey is LYUKOXZGVVRESV-SECBINFHSA-N. The full InChI is InChI=1S/C9H9ClFNO/c10-7-3-6(4-8(11)5-7)9-1-2-13-12-9/h3-5,9,12H,1-2H2/t9-/m1/s1.
What are the key properties of (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine?
(3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine has a molecular weight of 201.63 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(3-chloro-5-fluorophenyl)-1,2-oxazolidine is sourced from PubChem (CID 155128113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).