About (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine
(3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine (PubChem CID 155128118) has the molecular formula C9H8ClF2NO
and a molecular weight of 219.62 g/mol. Its IUPAC name is (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine.
Molecular Properties
| Compound Name | (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine |
| PubChem CID | 155128118 |
| Molecular Formula | C9H8ClF2NO |
| Molecular Weight | 219.62 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine |
| SMILES | Fc1cc(Cl)c(F)c([C@H]2CCON2)c1 |
| InChI | InChI=1S/C9H8ClF2NO/c10-7-4-5(11)3-6(9(7)12)8-1-2-14-13-8/h3-4,8,13H,1-2H2/t8-/m1/s1 |
| InChIKey | HFFDHINCUCZCKK-MRVPVSSYSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.62 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine?
The IUPAC name of (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine (CID 155128118) is (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine.
What is the SMILES notation for (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine?
The canonical SMILES for (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine is Fc1cc(Cl)c(F)c([C@H]2CCON2)c1.
What is the InChIKey of (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine?
The InChIKey is HFFDHINCUCZCKK-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H8ClF2NO/c10-7-4-5(11)3-6(9(7)12)8-1-2-14-13-8/h3-4,8,13H,1-2H2/t8-/m1/s1.
What are the key properties of (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine?
(3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine has a molecular weight of 219.62 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(3-chloro-2,5-difluorophenyl)-1,2-oxazolidine is sourced from PubChem (CID 155128118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).