C21H29F3 — CID 155128314
1-(trifluoromethyl)-4-[(5E)-5,6,10-trimethylundeca-5,9-dienyl]benzene (PubChem CID 155128314) has the molecular formula C21H29F3 and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-(trifluoromethyl)-4-[(5E)-5,6,10-trimethylundeca-5,9-dienyl]benzene.
| Compound Name | 1-(trifluoromethyl)-4-[(5E)-5,6,10-trimethylundeca-5,9-dienyl]benzene |
|---|---|
| PubChem CID | 155128314 |
| Molecular Formula | C21H29F3 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 1-(trifluoromethyl)-4-[(5E)-5,6,10-trimethylundeca-5,9-dienyl]benzene |
| SMILES | CC(C)=CCC/C(C)=C(\C)CCCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H29F3/c1-16(2)8-7-10-18(4)17(3)9-5-6-11-19-12-14-20(15-13-19)21(22,23)24/h8,12-15H,5-7,9-11H2,1-4H3/b18-17+ |
| InChIKey | HPAHREZBJCVKCW-ISLYRVAYSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|